C18H25N7 — CID 162067267
benzene-1,3-diamine;benzene-1,4-diamine;benzene-1,2,4-triamine (PubChem CID 162067267) has the molecular formula C18H25N7 and a molecular weight of 339.45 g/mol. Its IUPAC name is benzene-1,3-diamine;benzene-1,4-diamine;benzene-1,2,4-triamine.
| Compound Name | benzene-1,3-diamine;benzene-1,4-diamine;benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 162067267 |
| Molecular Formula | C18H25N7 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | benzene-1,3-diamine;benzene-1,4-diamine;benzene-1,2,4-triamine |
| SMILES | Nc1ccc(N)c(N)c1.Nc1ccc(N)cc1.Nc1cccc(N)c1 |
| InChI | InChI=1S/C6H9N3.2C6H8N2/c7-4-1-2-5(8)6(9)3-4;7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h1-3H,7-9H2;2*1-4H,7-8H2 |
| InChIKey | ZAPTVLNGZIJIAS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 182.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|