C18H21N5 — CID 160814118
aniline;4-(3,4-diaminophenyl)benzene-1,2-diamine (PubChem CID 160814118) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is aniline;4-(3,4-diaminophenyl)benzene-1,2-diamine.
| Compound Name | aniline;4-(3,4-diaminophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 160814118 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | aniline;4-(3,4-diaminophenyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(-c2ccc(N)c(N)c2)cc1N.Nc1ccccc1 |
| InChI | InChI=1S/C12H14N4.C6H7N/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;7-6-4-2-1-3-5-6/h1-6H,13-16H2;1-5H,7H2 |
| InChIKey | SERKKZYZIKVKIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|