C20H24N2O6 — CID 87611556
(3,4-dipropoxyphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate (PubChem CID 87611556) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is (3,4-dipropoxyphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate.
| Compound Name | (3,4-dipropoxyphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 87611556 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (3,4-dipropoxyphenyl) N-[4-(hydroxycarbamoyl)phenyl]carbamate |
| SMILES | CCCOc1ccc(OC(=O)Nc2ccc(C(=O)NO)cc2)cc1OCCC |
| InChI | InChI=1S/C20H24N2O6/c1-3-11-26-17-10-9-16(13-18(17)27-12-4-2)28-20(24)21-15-7-5-14(6-8-15)19(23)22-25/h5-10,13,25H,3-4,11-12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | APJIYVMPCUPOOL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|