C17H26N2O3 — CID 51922854
(2R)-2-acetamido-N-(5-tert-butyl-2-hydroxyphenyl)-3-methylbutanamide (PubChem CID 51922854) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2R)-2-acetamido-N-(5-tert-butyl-2-hydroxyphenyl)-3-methylbutanamide.
| Compound Name | (2R)-2-acetamido-N-(5-tert-butyl-2-hydroxyphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 51922854 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2R)-2-acetamido-N-(5-tert-butyl-2-hydroxyphenyl)-3-methylbutanamide |
| SMILES | CC(=O)N[C@@H](C(=O)Nc1cc(C(C)(C)C)ccc1O)C(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-10(2)15(18-11(3)20)16(22)19-13-9-12(17(4,5)6)7-8-14(13)21/h7-10,15,21H,1-6H3,(H,18,20)(H,19,22)/t15-/m1/s1 |
| InChIKey | NHJCSLNFBRJQCS-OAHLLOKOSA-N |
| XLogP | 2.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|