C14H17BrClNO2 — CID 172992187
tert-butyl 3-(3-bromo-4-chlorophenyl)azetidine-1-carboxylate (PubChem CID 172992187) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is tert-butyl 3-(3-bromo-4-chlorophenyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-bromo-4-chlorophenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172992187 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | tert-butyl 3-(3-bromo-4-chlorophenyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C14H17BrClNO2/c1-14(2,3)19-13(18)17-7-10(8-17)9-4-5-12(16)11(15)6-9/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | IUQQKUAXAATTPH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |