C14H18N2O3 — CID 177364546
tert-butyl 3-(4-nitrosophenyl)azetidine-1-carboxylate (PubChem CID 177364546) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl 3-(4-nitrosophenyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-nitrosophenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 177364546 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | tert-butyl 3-(4-nitrosophenyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(N=O)cc2)C1 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)19-13(17)16-8-11(9-16)10-4-6-12(15-18)7-5-10/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | DIIYLOBORXGNTI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |