C20H32N2O5 — CID 153399076
tert-butyl 3-methylpiperidine-1-carboxylate;ethane;4-nitrosobenzoic acid (PubChem CID 153399076) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl 3-methylpiperidine-1-carboxylate;ethane;4-nitrosobenzoic acid.
| Compound Name | tert-butyl 3-methylpiperidine-1-carboxylate;ethane;4-nitrosobenzoic acid |
|---|---|
| PubChem CID | 153399076 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | tert-butyl 3-methylpiperidine-1-carboxylate;ethane;4-nitrosobenzoic acid |
| SMILES | CC.CC1CCCN(C(=O)OC(C)(C)C)C1.O=Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H21NO2.C7H5NO3.C2H6/c1-9-6-5-7-12(8-9)10(13)14-11(2,3)4;9-7(10)5-1-3-6(8-11)4-2-5;1-2/h9H,5-8H2,1-4H3;1-4H,(H,9,10);1-2H3 |
| InChIKey | IWULZCBRCRMCRQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |