C18H23F3N2O2 — CID 162745692
tert-butyl 3-[4-[3-(trifluoromethyl)azetidin-1-yl]phenyl]azetidine-1-carboxylate (PubChem CID 162745692) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is tert-butyl 3-[4-[3-(trifluoromethyl)azetidin-1-yl]phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[3-(trifluoromethyl)azetidin-1-yl]phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162745692 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl 3-[4-[3-(trifluoromethyl)azetidin-1-yl]phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(N3CC(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-17(2,3)25-16(24)23-8-13(9-23)12-4-6-15(7-5-12)22-10-14(11-22)18(19,20)21/h4-7,13-14H,8-11H2,1-3H3 |
| InChIKey | BWJBUZIOJKRAKV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|