C14H26N4O2 — CID 122128001
2-[[(1-tert-butyltriazol-4-yl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122128001) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[[(1-tert-butyltriazol-4-yl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(1-tert-butyltriazol-4-yl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122128001 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-[[(1-tert-butyltriazol-4-yl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cn(C(C)(C)C)nn1)C(=O)O |
| InChI | InChI=1S/C14H26N4O2/c1-10(2)6-11(13(19)20)7-15-8-12-9-18(17-16-12)14(3,4)5/h9-11,15H,6-8H2,1-5H3,(H,19,20) |
| InChIKey | IHWRCFSLPKXPKR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |