C13H21F2N3O2 — CID 122128147
2-[[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122128147) has the molecular formula C13H21F2N3O2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122128147 |
| Molecular Formula | C13H21F2N3O2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cn(C)nc1C(F)F)C(=O)O |
| InChI | InChI=1S/C13H21F2N3O2/c1-8(2)4-9(13(19)20)5-16-6-10-7-18(3)17-11(10)12(14)15/h7-9,12,16H,4-6H2,1-3H3,(H,19,20) |
| InChIKey | JJPIWCPBGJWMQR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |