C22H33N3O2 — CID 122073257
2-[[(1-benzyl-3-tert-butylpyrazol-4-yl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122073257) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-[[(1-benzyl-3-tert-butylpyrazol-4-yl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(1-benzyl-3-tert-butylpyrazol-4-yl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122073257 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-[[(1-benzyl-3-tert-butylpyrazol-4-yl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cn(Cc2ccccc2)nc1C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H33N3O2/c1-16(2)11-18(21(26)27)12-23-13-19-15-25(24-20(19)22(3,4)5)14-17-9-7-6-8-10-17/h6-10,15-16,18,23H,11-14H2,1-5H3,(H,26,27) |
| InChIKey | YGTOKMSNCWGNCI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |