C20H26N4O2 — CID 122127612
2-[[[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122127612) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[[[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127612 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-[[[1-(2-cyanoethyl)-3-phenylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cn(CCC#N)nc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H26N4O2/c1-15(2)11-17(20(25)26)12-22-13-18-14-24(10-6-9-21)23-19(18)16-7-4-3-5-8-16/h3-5,7-8,14-15,17,22H,6,10-13H2,1-2H3,(H,25,26) |
| InChIKey | MKUXDQMBZSZNAK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |