C19H24N4O2 — CID 122127805
2-[[[3-(4-cyanophenyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122127805) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[[[3-(4-cyanophenyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[3-(4-cyanophenyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127805 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[[[3-(4-cyanophenyl)-1-methylpyrazol-4-yl]methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cn(C)nc1-c1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C19H24N4O2/c1-13(2)8-16(19(24)25)10-21-11-17-12-23(3)22-18(17)15-6-4-14(9-20)5-7-15/h4-7,12-13,16,21H,8,10-11H2,1-3H3,(H,24,25) |
| InChIKey | SZWGQSHARCOUAZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |