C16H18N4S — CID 129432487
4-[1-methyl-4-[[[(3R)-thiolan-3-yl]amino]methyl]pyrazol-3-yl]benzonitrile (PubChem CID 129432487) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-[1-methyl-4-[[[(3R)-thiolan-3-yl]amino]methyl]pyrazol-3-yl]benzonitrile.
| Compound Name | 4-[1-methyl-4-[[[(3R)-thiolan-3-yl]amino]methyl]pyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 129432487 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[1-methyl-4-[[[(3R)-thiolan-3-yl]amino]methyl]pyrazol-3-yl]benzonitrile |
| SMILES | Cn1cc(CN[C@@H]2CCSC2)c(-c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C16H18N4S/c1-20-10-14(9-18-15-6-7-21-11-15)16(19-20)13-4-2-12(8-17)3-5-13/h2-5,10,15,18H,6-7,9,11H2,1H3/t15-/m1/s1 |
| InChIKey | DFHUTNCCNQMBNA-OAHLLOKOSA-N |
| XLogP | 2.55 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |