C11H22N4 — CID 103398443
N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylpropan-2-amine (PubChem CID 103398443) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 103398443 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C11H22N4/c1-10(2,3)12-7-9-8-15(14-13-9)11(4,5)6/h8,12H,7H2,1-6H3 |
| InChIKey | UTKXANFYQRQJCE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |