C13H17FN4 — CID 103398542
N-[(1-tert-butyltriazol-4-yl)methyl]-4-fluoroaniline (PubChem CID 103398542) has the molecular formula C13H17FN4 and a molecular weight of 248.30 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-4-fluoroaniline.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 103398542 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-4-fluoroaniline |
| SMILES | CC(C)(C)n1cc(CNc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C13H17FN4/c1-13(2,3)18-9-12(16-17-18)8-15-11-6-4-10(14)5-7-11/h4-7,9,15H,8H2,1-3H3 |
| InChIKey | LJQZDVHFJIUMPY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |