C14H20N4S — CID 103398743
N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylsulfanylaniline (PubChem CID 103398743) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylsulfanylaniline.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 103398743 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-methylsulfanylaniline |
| SMILES | CSc1ccccc1NCc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C14H20N4S/c1-14(2,3)18-10-11(16-17-18)9-15-12-7-5-6-8-13(12)19-4/h5-8,10,15H,9H2,1-4H3 |
| InChIKey | NPLIENYEAFSBQJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |