C14H19FN4 — CID 103399011
N-[(1-tert-butyltriazol-4-yl)methyl]-3-fluoro-2-methylaniline (PubChem CID 103399011) has the molecular formula C14H19FN4 and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-3-fluoro-2-methylaniline.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-3-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 103399011 |
| Molecular Formula | C14H19FN4 |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-3-fluoro-2-methylaniline |
| SMILES | Cc1c(F)cccc1NCc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C14H19FN4/c1-10-12(15)6-5-7-13(10)16-8-11-9-19(18-17-11)14(2,3)4/h5-7,9,16H,8H2,1-4H3 |
| InChIKey | PCTIUNXORKJESH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |