C13H16F2N4 — CID 103398549
N-[(1-tert-butyltriazol-4-yl)methyl]-2,4-difluoroaniline (PubChem CID 103398549) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2,4-difluoroaniline.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 103398549 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2,4-difluoroaniline |
| SMILES | CC(C)(C)n1cc(CNc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C13H16F2N4/c1-13(2,3)19-8-10(17-18-19)7-16-12-5-4-9(14)6-11(12)15/h4-6,8,16H,7H2,1-3H3 |
| InChIKey | DTJZIMALEWYZNW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |