C11H12F2N4S — CID 62756281
2-(difluoromethylsulfanyl)-N-[(1-methyltriazol-4-yl)methyl]aniline (PubChem CID 62756281) has the molecular formula C11H12F2N4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(1-methyltriazol-4-yl)methyl]aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(1-methyltriazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62756281 |
| Molecular Formula | C11H12F2N4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(1-methyltriazol-4-yl)methyl]aniline |
| SMILES | Cn1cc(CNc2ccccc2SC(F)F)nn1 |
| InChI | InChI=1S/C11H12F2N4S/c1-17-7-8(15-16-17)6-14-9-4-2-3-5-10(9)18-11(12)13/h2-5,7,11,14H,6H2,1H3 |
| InChIKey | VPMUXHPBDSOEIK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |