C10H11BrN4 — CID 62756659
2-bromo-N-[(1-methyltriazol-4-yl)methyl]aniline (PubChem CID 62756659) has the molecular formula C10H11BrN4 and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-bromo-N-[(1-methyltriazol-4-yl)methyl]aniline.
| Compound Name | 2-bromo-N-[(1-methyltriazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62756659 |
| Molecular Formula | C10H11BrN4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2-bromo-N-[(1-methyltriazol-4-yl)methyl]aniline |
| SMILES | Cn1cc(CNc2ccccc2Br)nn1 |
| InChI | InChI=1S/C10H11BrN4/c1-15-7-8(13-14-15)6-12-10-5-3-2-4-9(10)11/h2-5,7,12H,6H2,1H3 |
| InChIKey | YBQJWWOANJXXPU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |