C13H24N4 — CID 103527388
N-[(1-tert-butyltriazol-4-yl)methyl]-2-cyclopropylpropan-2-amine (PubChem CID 103527388) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2-cyclopropylpropan-2-amine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-cyclopropylpropan-2-amine |
|---|---|
| PubChem CID | 103527388 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-cyclopropylpropan-2-amine |
| SMILES | CC(C)(NCc1cn(C(C)(C)C)nn1)C1CC1 |
| InChI | InChI=1S/C13H24N4/c1-12(2,3)17-9-11(15-16-17)8-14-13(4,5)10-6-7-10/h9-10,14H,6-8H2,1-5H3 |
| InChIKey | NIKOHZFPBHXXOT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |