C16H30N4 — CID 103399276
(1R)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-cycloheptylethanamine (PubChem CID 103399276) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is (1R)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-cycloheptylethanamine.
| Compound Name | (1R)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-cycloheptylethanamine |
|---|---|
| PubChem CID | 103399276 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | (1R)-N-[(1-tert-butyltriazol-4-yl)methyl]-1-cycloheptylethanamine |
| SMILES | C[C@@H](NCc1cn(C(C)(C)C)nn1)C1CCCCCC1 |
| InChI | InChI=1S/C16H30N4/c1-13(14-9-7-5-6-8-10-14)17-11-15-12-20(19-18-15)16(2,3)4/h12-14,17H,5-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | QZUDBIMXZMQGIZ-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |