C12H20N6O — CID 103527111
N-[(1-tert-butyltriazol-4-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 103527111) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103527111 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Cc1nc(CCNCc2cn(C(C)(C)C)nn2)no1 |
| InChI | InChI=1S/C12H20N6O/c1-9-14-11(16-19-9)5-6-13-7-10-8-18(17-15-10)12(2,3)4/h8,13H,5-7H2,1-4H3 |
| InChIKey | AJSCMAVJXLCUNQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|