C15H29N5 — CID 103399101
N-[(1-tert-butyltriazol-4-yl)methyl]-N'-cyclopentyl-N'-methylethane-1,2-diamine (PubChem CID 103399101) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is N-[(1-tert-butyltriazol-4-yl)methyl]-N'-cyclopentyl-N'-methylethane-1,2-diamine.
| Compound Name | N-[(1-tert-butyltriazol-4-yl)methyl]-N'-cyclopentyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 103399101 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[(1-tert-butyltriazol-4-yl)methyl]-N'-cyclopentyl-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1cn(C(C)(C)C)nn1)C1CCCC1 |
| InChI | InChI=1S/C15H29N5/c1-15(2,3)20-12-13(17-18-20)11-16-9-10-19(4)14-7-5-6-8-14/h12,14,16H,5-11H2,1-4H3 |
| InChIKey | HYFMEXKKXPZMKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|