C9H18N4O — CID 62757060
3-methoxy-2-methyl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 62757060) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-methoxy-2-methyl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62757060 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 3-methoxy-2-methyl-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | COCC(C)CNCc1cn(C)nn1 |
| InChI | InChI=1S/C9H18N4O/c1-8(7-14-3)4-10-5-9-6-13(2)12-11-9/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | ZQWQHMCKKPCYGA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |