C8H16N4O — CID 104980852
(2S)-2-[(1-methyltriazol-4-yl)methylamino]butan-1-ol (PubChem CID 104980852) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is (2S)-2-[(1-methyltriazol-4-yl)methylamino]butan-1-ol.
| Compound Name | (2S)-2-[(1-methyltriazol-4-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 104980852 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (2S)-2-[(1-methyltriazol-4-yl)methylamino]butan-1-ol |
| SMILES | CC[C@@H](CO)NCc1cn(C)nn1 |
| InChI | InChI=1S/C8H16N4O/c1-3-7(6-13)9-4-8-5-12(2)11-10-8/h5,7,9,13H,3-4,6H2,1-2H3/t7-/m0/s1 |
| InChIKey | IFCQICSJIZOIEL-ZETCQYMHSA-N |
| XLogP | -0.32 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |