C13H16Cl2N4O — CID 75503411
2-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]butan-1-ol (PubChem CID 75503411) has the molecular formula C13H16Cl2N4O and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]butan-1-ol.
| Compound Name | 2-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 75503411 |
| Molecular Formula | C13H16Cl2N4O |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[[1-(3,4-dichlorophenyl)triazol-4-yl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1cn(-c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C13H16Cl2N4O/c1-2-9(8-20)16-6-10-7-19(18-17-10)11-3-4-12(14)13(15)5-11/h3-5,7,9,16,20H,2,6,8H2,1H3 |
| InChIKey | LAAUCOPWBIYZBX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |