C14H10Cl3N5 — CID 167872795
6-chloro-N-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]pyridin-3-amine (PubChem CID 167872795) has the molecular formula C14H10Cl3N5 and a molecular weight of 354.63 g/mol. Its IUPAC name is 6-chloro-N-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]pyridin-3-amine.
| Compound Name | 6-chloro-N-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 167872795 |
| Molecular Formula | C14H10Cl3N5 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 6-chloro-N-[[1-(3,4-dichlorophenyl)triazol-4-yl]methyl]pyridin-3-amine |
| SMILES | Clc1ccc(NCc2cn(-c3ccc(Cl)c(Cl)c3)nn2)cn1 |
| InChI | InChI=1S/C14H10Cl3N5/c15-12-3-2-11(5-13(12)16)22-8-10(20-21-22)7-18-9-1-4-14(17)19-6-9/h1-6,8,18H,7H2 |
| InChIKey | RZTLABCTVMLOCK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|