C16H15ClN4O — CID 75516751
[3-[[1-(4-chlorophenyl)triazol-4-yl]methylamino]phenyl]methanol (PubChem CID 75516751) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is [3-[[1-(4-chlorophenyl)triazol-4-yl]methylamino]phenyl]methanol.
| Compound Name | [3-[[1-(4-chlorophenyl)triazol-4-yl]methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 75516751 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [3-[[1-(4-chlorophenyl)triazol-4-yl]methylamino]phenyl]methanol |
| SMILES | OCc1cccc(NCc2cn(-c3ccc(Cl)cc3)nn2)c1 |
| InChI | InChI=1S/C16H15ClN4O/c17-13-4-6-16(7-5-13)21-10-15(19-20-21)9-18-14-3-1-2-12(8-14)11-22/h1-8,10,18,22H,9,11H2 |
| InChIKey | WSUWJVMDIIGBDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |