C15H18ClFN4O2 — CID 120510303
2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]hexanoic acid (PubChem CID 120510303) has the molecular formula C15H18ClFN4O2 and a molecular weight of 340.79 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]hexanoic acid.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120510303 |
| Molecular Formula | C15H18ClFN4O2 |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methylamino]hexanoic acid |
| SMILES | CCCCC(NCc1cn(-c2ccc(F)c(Cl)c2)nn1)C(=O)O |
| InChI | InChI=1S/C15H18ClFN4O2/c1-2-3-4-14(15(22)23)18-8-10-9-21(20-19-10)11-5-6-13(17)12(16)7-11/h5-7,9,14,18H,2-4,8H2,1H3,(H,22,23) |
| InChIKey | ISJHFSPKRWBBOU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |