C16H27N5 — CID 83075859
N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-4-imidazol-1-ylbutan-1-amine (PubChem CID 83075859) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-4-imidazol-1-ylbutan-1-amine.
| Compound Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-4-imidazol-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 83075859 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-4-imidazol-1-ylbutan-1-amine |
| SMILES | Cn1cc(CNCCCCn2ccnc2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H27N5/c1-16(2,3)15-14(12-20(4)19-15)11-17-7-5-6-9-21-10-8-18-13-21/h8,10,12-13,17H,5-7,9,11H2,1-4H3 |
| InChIKey | CQNCDNBBQFUSLW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|