C13H25N3OS — CID 115883596
N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-3-methylsulfinylpropan-1-amine (PubChem CID 115883596) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-3-methylsulfinylpropan-1-amine.
| Compound Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-3-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 115883596 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[(3-tert-butyl-1-methylpyrazol-4-yl)methyl]-3-methylsulfinylpropan-1-amine |
| SMILES | Cn1cc(CNCCCS(C)=O)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H25N3OS/c1-13(2,3)12-11(10-16(4)15-12)9-14-7-6-8-18(5)17/h10,14H,6-9H2,1-5H3 |
| InChIKey | GABCJWFMAPINJI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|