C11H18N6O — CID 66268182
3-[4-[(2-imidazol-1-ylethylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66268182) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 3-[4-[(2-imidazol-1-ylethylamino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(2-imidazol-1-ylethylamino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66268182 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-[4-[(2-imidazol-1-ylethylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCCn2ccnc2)nn1 |
| InChI | InChI=1S/C11H18N6O/c18-7-1-4-17-9-11(14-15-17)8-12-2-5-16-6-3-13-10-16/h3,6,9-10,12,18H,1-2,4-5,7-8H2 |
| InChIKey | ZVWPPRWXDBRRSK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|