C12H18N4O2 — CID 66269867
3-[4-[[2-(furan-2-yl)ethylamino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 66269867) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[4-[[2-(furan-2-yl)ethylamino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[2-(furan-2-yl)ethylamino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66269867 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[4-[[2-(furan-2-yl)ethylamino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCCc2ccco2)nn1 |
| InChI | InChI=1S/C12H18N4O2/c17-7-2-6-16-10-11(14-15-16)9-13-5-4-12-3-1-8-18-12/h1,3,8,10,13,17H,2,4-7,9H2 |
| InChIKey | TUBNAWPNVSNSFE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|