C9H14N6 — CID 62055653
[1-(3-imidazol-1-ylpropyl)triazol-4-yl]methanamine (PubChem CID 62055653) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is [1-(3-imidazol-1-ylpropyl)triazol-4-yl]methanamine.
| Compound Name | [1-(3-imidazol-1-ylpropyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 62055653 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | [1-(3-imidazol-1-ylpropyl)triazol-4-yl]methanamine |
| SMILES | NCc1cn(CCCn2ccnc2)nn1 |
| InChI | InChI=1S/C9H14N6/c10-6-9-7-15(13-12-9)4-1-3-14-5-2-11-8-14/h2,5,7-8H,1,3-4,6,10H2 |
| InChIKey | WKROVMHXTXNHRA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |