C16H26N2O3 — CID 43425240
methyl 3-[[[1-(dimethylamino)cyclohexyl]methylamino]methyl]furan-2-carboxylate (PubChem CID 43425240) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 3-[[[1-(dimethylamino)cyclohexyl]methylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[[1-(dimethylamino)cyclohexyl]methylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 43425240 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | methyl 3-[[[1-(dimethylamino)cyclohexyl]methylamino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNCC1(N(C)C)CCCCC1 |
| InChI | InChI=1S/C16H26N2O3/c1-18(2)16(8-5-4-6-9-16)12-17-11-13-7-10-21-14(13)15(19)20-3/h7,10,17H,4-6,8-9,11-12H2,1-3H3 |
| InChIKey | PHSCYCZBAPSLRE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |