C12H18N2O3 — CID 83006477
methyl 3-[(piperidin-1-ylamino)methyl]furan-2-carboxylate (PubChem CID 83006477) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl 3-[(piperidin-1-ylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(piperidin-1-ylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 83006477 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl 3-[(piperidin-1-ylamino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNN1CCCCC1 |
| InChI | InChI=1S/C12H18N2O3/c1-16-12(15)11-10(5-8-17-11)9-13-14-6-3-2-4-7-14/h5,8,13H,2-4,6-7,9H2,1H3 |
| InChIKey | ZWECTKJOPRICJM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |