C12H20N2O5S — CID 63858594
methyl 3-[[[2-(methanesulfonamido)-2-methylpropyl]amino]methyl]furan-2-carboxylate (PubChem CID 63858594) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 3-[[[2-(methanesulfonamido)-2-methylpropyl]amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[[2-(methanesulfonamido)-2-methylpropyl]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 63858594 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methyl 3-[[[2-(methanesulfonamido)-2-methylpropyl]amino]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O5S/c1-12(2,14-20(4,16)17)8-13-7-9-5-6-19-10(9)11(15)18-3/h5-6,13-14H,7-8H2,1-4H3 |
| InChIKey | IQGUERSSDKHYMV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |