C14H23NO3S — CID 103923443
methyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]furan-2-carboxylate (PubChem CID 103923443) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is methyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103923443 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]furan-2-carboxylate |
| SMILES | CCC(CC)(CNCc1ccoc1C(=O)OC)SC |
| InChI | InChI=1S/C14H23NO3S/c1-5-14(6-2,19-4)10-15-9-11-7-8-18-12(11)13(16)17-3/h7-8,15H,5-6,9-10H2,1-4H3 |
| InChIKey | ITTFJJYJTXAAGB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |