C10H11F4NO3 — CID 103529404
methyl 3-[(2,2,3,3-tetrafluoropropylamino)methyl]furan-2-carboxylate (PubChem CID 103529404) has the molecular formula C10H11F4NO3 and a molecular weight of 269.19 g/mol. Its IUPAC name is methyl 3-[(2,2,3,3-tetrafluoropropylamino)methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(2,2,3,3-tetrafluoropropylamino)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103529404 |
| Molecular Formula | C10H11F4NO3 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 3-[(2,2,3,3-tetrafluoropropylamino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H11F4NO3/c1-17-8(16)7-6(2-3-18-7)4-15-5-10(13,14)9(11)12/h2-3,9,15H,4-5H2,1H3 |
| InChIKey | BUSUQHXYFMHVIM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|