C12H15NO4S — CID 58938225
methyl 3-[(4-ethoxy-4-oxobut-1-en-2-yl)amino]thiophene-2-carboxylate (PubChem CID 58938225) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl 3-[(4-ethoxy-4-oxobut-1-en-2-yl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-ethoxy-4-oxobut-1-en-2-yl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 58938225 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 3-[(4-ethoxy-4-oxobut-1-en-2-yl)amino]thiophene-2-carboxylate |
| SMILES | C=C(CC(=O)OCC)Nc1ccsc1C(=O)OC |
| InChI | InChI=1S/C12H15NO4S/c1-4-17-10(14)7-8(2)13-9-5-6-18-11(9)12(15)16-3/h5-6,13H,2,4,7H2,1,3H3 |
| InChIKey | SMBWMWUOPWKQSF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |