About methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate
methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate (PubChem CID 93038584) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate |
| PubChem CID | 93038584 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)[C@@H]1C[C@H]1C |
| InChI | InChI=1S/C11H13NO3S/c1-6-5-7(6)10(13)12-8-3-4-16-9(8)11(14)15-2/h3-4,6-7H,5H2,1-2H3,(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | WNUUPAXJWOBHKE-RNFRBKRXSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate (CID 93038584) is methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)[C@@H]1C[C@H]1C.
What is the InChIKey of methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate?
The InChIKey is WNUUPAXJWOBHKE-RNFRBKRXSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-6-5-7(6)10(13)12-8-3-4-16-9(8)11(14)15-2/h3-4,6-7H,5H2,1-2H3,(H,12,13)/t6-,7-/m1/s1.
What are the key properties of methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate?
methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate has a molecular weight of 239.30 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 93038584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).