C15H20N2O3S — CID 61259005
methyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)thiophene-2-carboxylate (PubChem CID 61259005) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 61259005 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C15H20N2O3S/c1-20-15(19)13-11(6-7-21-13)17-14(18)12-8-9-4-2-3-5-10(9)16-12/h6-7,9-10,12,16H,2-5,8H2,1H3,(H,17,18) |
| InChIKey | SNUNLUIFAKALNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |