C15H23Cl2N3O — CID 119876308
N-(3-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119876308) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.28 g/mol. Its IUPAC name is N-(3-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119876308 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(3-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cc1cnccc1NC(=O)C1CC2CCCCC2N1.Cl.Cl |
| InChI | InChI=1S/C15H21N3O.2ClH/c1-10-9-16-7-6-12(10)18-15(19)14-8-11-4-2-3-5-13(11)17-14;;/h6-7,9,11,13-14,17H,2-5,8H2,1H3,(H,16,18,19);2*1H |
| InChIKey | AMWCBMSSORSXEO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |