C17H22Cl2N4O — CID 119888990
N-(1,6-naphthyridin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119888990) has the molecular formula C17H22Cl2N4O and a molecular weight of 369.30 g/mol. Its IUPAC name is N-(1,6-naphthyridin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-(1,6-naphthyridin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119888990 |
| Molecular Formula | C17H22Cl2N4O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-(1,6-naphthyridin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccnc2ccncc12)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H20N4O.2ClH/c22-17(16-9-11-3-1-2-4-13(11)20-16)21-15-6-8-19-14-5-7-18-10-12(14)15;;/h5-8,10-11,13,16,20H,1-4,9H2,(H,19,21,22);2*1H |
| InChIKey | BMRKLTJSDRVKBQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |