C16H19N3OS — CID 103795576
N-(1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 103795576) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 103795576 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2ncsc2c1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(14-7-10-3-1-2-4-12(10)19-14)18-11-5-6-13-15(8-11)21-9-17-13/h5-6,8-10,12,14,19H,1-4,7H2,(H,18,20) |
| InChIKey | AQTULAYMLKHFQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |