C15H19N3O6S — CID 75400277
methyl 4-[[2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoacetyl]amino]piperidine-1-carboxylate (PubChem CID 75400277) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is methyl 4-[[2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoacetyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75400277 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | methyl 4-[[2-[(2-methoxycarbonylthiophen-3-yl)amino]-2-oxoacetyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)C(=O)NC1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H19N3O6S/c1-23-14(21)11-10(5-8-25-11)17-13(20)12(19)16-9-3-6-18(7-4-9)15(22)24-2/h5,8-9H,3-4,6-7H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | ZBBBKBMIPQANIH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|