C13H19N3O3S — CID 115300730
methyl 3-[[2-[3-(methylamino)pyrrolidin-1-yl]acetyl]amino]thiophene-2-carboxylate (PubChem CID 115300730) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 3-[[2-[3-(methylamino)pyrrolidin-1-yl]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[3-(methylamino)pyrrolidin-1-yl]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 115300730 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | methyl 3-[[2-[3-(methylamino)pyrrolidin-1-yl]acetyl]amino]thiophene-2-carboxylate |
| SMILES | CNC1CCN(CC(=O)Nc2ccsc2C(=O)OC)C1 |
| InChI | InChI=1S/C13H19N3O3S/c1-14-9-3-5-16(7-9)8-11(17)15-10-4-6-20-12(10)13(18)19-2/h4,6,9,14H,3,5,7-8H2,1-2H3,(H,15,17) |
| InChIKey | KRGNDWLLYRDNFG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |