C20H27N3O4S2 — CID 100568977
dimethyl 5-[[4-(thian-4-yl)piperazine-1-carbothioyl]amino]benzene-1,3-dicarboxylate (PubChem CID 100568977) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is dimethyl 5-[[4-(thian-4-yl)piperazine-1-carbothioyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-(thian-4-yl)piperazine-1-carbothioyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 100568977 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | dimethyl 5-[[4-(thian-4-yl)piperazine-1-carbothioyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)N2CCN(C3CCSCC3)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H27N3O4S2/c1-26-18(24)14-11-15(19(25)27-2)13-16(12-14)21-20(28)23-7-5-22(6-8-23)17-3-9-29-10-4-17/h11-13,17H,3-10H2,1-2H3,(H,21,28) |
| InChIKey | VJSHPFUWEZVJKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|